C13H18N2O — CID 117005173
4-(2,5-dimethylphenyl)-1-methylpiperazin-2-one (PubChem CID 117005173) has the molecular formula C13H18N2O and a molecular weight of 218.30 g/mol. Its IUPAC name is 4-(2,5-dimethylphenyl)-1-methylpiperazin-2-one.
| Compound Name | 4-(2,5-dimethylphenyl)-1-methylpiperazin-2-one |
|---|---|
| PubChem CID | 117005173 |
| Molecular Formula | C13H18N2O |
| Molecular Weight | 218.30 g/mol |
| Exact Mass | 218.14 |
| IUPAC Name | 4-(2,5-dimethylphenyl)-1-methylpiperazin-2-one |
| SMILES | Cc1ccc(C)c(N2CCN(C)C(=O)C2)c1 |
| InChI | InChI=1S/C13H18N2O/c1-10-4-5-11(2)12(8-10)15-7-6-14(3)13(16)9-15/h4-5,8H,6-7,9H2,1-3H3 |
| InChIKey | INTKJWWQEDVMID-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.30 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |