About 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide
2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide (PubChem CID 107536062) has the molecular formula C14H19BrFN3OS
and a molecular weight of 376.30 g/mol. Its IUPAC name is 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide.
Molecular Properties
| Compound Name | 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide |
| PubChem CID | 107536062 |
| Molecular Formula | C14H19BrFN3OS |
| Molecular Weight | 376.30 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide |
| SMILES | CC1(C)CCN(c2ccc(/C(N)=N/O)c(Br)c2F)CCS1 |
| InChI | InChI=1S/C14H19BrFN3OS/c1-14(2)5-6-19(7-8-21-14)10-4-3-9(13(17)18-20)11(15)12(10)16/h3-4,20H,5-8H2,1-2H3,(H2,17,18) |
| InChIKey | PLFIDXYODBMXKQ-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 61.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 376.30 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide?
The IUPAC name of 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide (CID 107536062) is 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide.
What is the SMILES notation for 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide?
The canonical SMILES for 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide is CC1(C)CCN(c2ccc(/C(N)=N/O)c(Br)c2F)CCS1.
What is the InChIKey of 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide?
The InChIKey is PLFIDXYODBMXKQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19BrFN3OS/c1-14(2)5-6-19(7-8-21-14)10-4-3-9(13(17)18-20)11(15)12(10)16/h3-4,20H,5-8H2,1-2H3,(H2,17,18).
What are the key properties of 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide?
2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide has a molecular weight of 376.30 g/mol, XLogP of 3.40, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-4-(7,7-dimethyl-1,4-thiazepan-4-yl)-3-fluoro-N'-hydroxybenzenecarboximidamide is sourced from PubChem (CID 107536062), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).