C16H22BrN3 — CID 114904588
2-(8-azaspiro[4.5]decan-8-yl)-4-bromobenzenecarboximidamide (PubChem CID 114904588) has the molecular formula C16H22BrN3 and a molecular weight of 336.28 g/mol. Its IUPAC name is 2-(8-azaspiro[4.5]decan-8-yl)-4-bromobenzenecarboximidamide.
| Compound Name | 2-(8-azaspiro[4.5]decan-8-yl)-4-bromobenzenecarboximidamide |
|---|---|
| PubChem CID | 114904588 |
| Molecular Formula | C16H22BrN3 |
| Molecular Weight | 336.28 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 2-(8-azaspiro[4.5]decan-8-yl)-4-bromobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(Br)cc1N1CCC2(CCCC2)CC1 |
| InChI | InChI=1S/C16H22BrN3/c17-12-3-4-13(15(18)19)14(11-12)20-9-7-16(8-10-20)5-1-2-6-16/h3-4,11H,1-2,5-10H2,(H3,18,19) |
| InChIKey | QYVZZHSFHKRNIH-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.28 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|