C14H15F3N4 — CID 61226958
5-(trifluoromethyl)-2-(3,4,5-trimethylpyrazol-1-yl)benzenecarboximidamide (PubChem CID 61226958) has the molecular formula C14H15F3N4 and a molecular weight of 296.30 g/mol. Its IUPAC name is 5-(trifluoromethyl)-2-(3,4,5-trimethylpyrazol-1-yl)benzenecarboximidamide.
| Compound Name | 5-(trifluoromethyl)-2-(3,4,5-trimethylpyrazol-1-yl)benzenecarboximidamide |
|---|---|
| PubChem CID | 61226958 |
| Molecular Formula | C14H15F3N4 |
| Molecular Weight | 296.30 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 5-(trifluoromethyl)-2-(3,4,5-trimethylpyrazol-1-yl)benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1cc(C(F)(F)F)ccc1-n1nc(C)c(C)c1C |
| InChI | InChI=1S/C14H15F3N4/c1-7-8(2)20-21(9(7)3)12-5-4-10(14(15,16)17)6-11(12)13(18)19/h4-6H,1-3H3,(H3,18,19) |
| InChIKey | RVWFAEUQLKVXSE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.30 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|