C11H9Br2ClN2 — CID 121232084
6,7-dibromonaphthalene-2-carboximidamide;hydrochloride (PubChem CID 121232084) has the molecular formula C11H9Br2ClN2 and a molecular weight of 364.47 g/mol. Its IUPAC name is 6,7-dibromonaphthalene-2-carboximidamide;hydrochloride.
| Compound Name | 6,7-dibromonaphthalene-2-carboximidamide;hydrochloride |
|---|---|
| PubChem CID | 121232084 |
| Molecular Formula | C11H9Br2ClN2 |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 361.88 |
| IUPAC Name | 6,7-dibromonaphthalene-2-carboximidamide;hydrochloride |
| SMILES | Cl.[H]/N=C(\N)c1ccc2cc(Br)c(Br)cc2c1 |
| InChI | InChI=1S/C11H8Br2N2.ClH/c12-9-4-6-1-2-7(11(14)15)3-8(6)5-10(9)13;/h1-5H,(H3,14,15);1H |
| InChIKey | RGRMCNXIQRQARS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|