C15H14FN3O2S — CID 90106153
(4-carbamimidoyl-2-fluorophenyl) 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxylate (PubChem CID 90106153) has the molecular formula C15H14FN3O2S and a molecular weight of 319.36 g/mol. Its IUPAC name is (4-carbamimidoyl-2-fluorophenyl) 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxylate.
| Compound Name | (4-carbamimidoyl-2-fluorophenyl) 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxylate |
|---|---|
| PubChem CID | 90106153 |
| Molecular Formula | C15H14FN3O2S |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | (4-carbamimidoyl-2-fluorophenyl) 4,5,6,7-tetrahydrothieno[2,3-c]pyridine-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2cc3c(s2)CNCC3)c(F)c1 |
| InChI | InChI=1S/C15H14FN3O2S/c16-10-5-9(14(17)18)1-2-11(10)21-15(20)12-6-8-3-4-19-7-13(8)22-12/h1-2,5-6,19H,3-4,7H2,(H3,17,18) |
| InChIKey | NXTXQRAVVHQKHW-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 88.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|