C20H23FN6O3S — CID 90070246
(4-carbamimidoyl-2-fluorophenyl) 5-[3-[2-(1,2-dihydrotriazet-4-yl)ethylamino]-2,2-dimethyl-3-oxopropyl]thiophene-2-carboxylate (PubChem CID 90070246) has the molecular formula C20H23FN6O3S and a molecular weight of 446.51 g/mol. Its IUPAC name is (4-carbamimidoyl-2-fluorophenyl) 5-[3-[2-(1,2-dihydrotriazet-4-yl)ethylamino]-2,2-dimethyl-3-oxopropyl]thiophene-2-carboxylate.
| Compound Name | (4-carbamimidoyl-2-fluorophenyl) 5-[3-[2-(1,2-dihydrotriazet-4-yl)ethylamino]-2,2-dimethyl-3-oxopropyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 90070246 |
| Molecular Formula | C20H23FN6O3S |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.15 |
| IUPAC Name | (4-carbamimidoyl-2-fluorophenyl) 5-[3-[2-(1,2-dihydrotriazet-4-yl)ethylamino]-2,2-dimethyl-3-oxopropyl]thiophene-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(CC(C)(C)C(=O)NCCc3n[nH][nH]3)s2)c(F)c1 |
| InChI | InChI=1S/C20H23FN6O3S/c1-20(2,19(29)24-8-7-16-25-27-26-16)10-12-4-6-15(31-12)18(28)30-14-5-3-11(17(22)23)9-13(14)21/h3-6,9,27H,7-8,10H2,1-2H3,(H3,22,23)(H,24,29)(H,25,26) |
| InChIKey | LFCVDDSPVSXNFB-UHFFFAOYSA-N |
| XLogP | 2.37 |
| TPSA | 149.74 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 2.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|