C24H30N3O5PS — CID 155107156
1-[[3-[5-(4-carbamimidoyl-2-phosphanylphenoxy)carbonylthiophen-2-yl]-2,2-dimethylpropanoyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 155107156) has the molecular formula C24H30N3O5PS and a molecular weight of 503.56 g/mol. Its IUPAC name is 1-[[3-[5-(4-carbamimidoyl-2-phosphanylphenoxy)carbonylthiophen-2-yl]-2,2-dimethylpropanoyl]amino]cyclohexane-1-carboxylic acid.
| Compound Name | 1-[[3-[5-(4-carbamimidoyl-2-phosphanylphenoxy)carbonylthiophen-2-yl]-2,2-dimethylpropanoyl]amino]cyclohexane-1-carboxylic acid |
|---|---|
| PubChem CID | 155107156 |
| Molecular Formula | C24H30N3O5PS |
| Molecular Weight | 503.56 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | 1-[[3-[5-(4-carbamimidoyl-2-phosphanylphenoxy)carbonylthiophen-2-yl]-2,2-dimethylpropanoyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(CC(C)(C)C(=O)NC3(C(=O)O)CCCCC3)s2)c(P)c1 |
| InChI | InChI=1S/C24H30N3O5PS/c1-23(2,21(29)27-24(22(30)31)10-4-3-5-11-24)13-15-7-9-18(34-15)20(28)32-16-8-6-14(19(25)26)12-17(16)33/h6-9,12H,3-5,10-11,13,33H2,1-2H3,(H3,25,26)(H,27,29)(H,30,31) |
| InChIKey | WMHDNFYAMMKOPF-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 142.57 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.56 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|