C25H28FN3O7S — CID 159853910
(2S)-2-[2-[1-[[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]methyl-methylamino]cyclopentyl]-2-oxoethyl]butanedioic acid (PubChem CID 159853910) has the molecular formula C25H28FN3O7S and a molecular weight of 533.58 g/mol. Its IUPAC name is (2S)-2-[2-[1-[[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]methyl-methylamino]cyclopentyl]-2-oxoethyl]butanedioic acid.
| Compound Name | (2S)-2-[2-[1-[[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]methyl-methylamino]cyclopentyl]-2-oxoethyl]butanedioic acid |
|---|---|
| PubChem CID | 159853910 |
| Molecular Formula | C25H28FN3O7S |
| Molecular Weight | 533.58 g/mol |
| Exact Mass | 533.16 |
| IUPAC Name | (2S)-2-[2-[1-[[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]methyl-methylamino]cyclopentyl]-2-oxoethyl]butanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(CN(C)C3(C(=O)C[C@@H](CC(=O)O)C(=O)O)CCCC3)s2)c(F)c1 |
| InChI | InChI=1S/C25H28FN3O7S/c1-29(25(8-2-3-9-25)20(30)11-15(23(33)34)12-21(31)32)13-16-5-7-19(37-16)24(35)36-18-6-4-14(22(27)28)10-17(18)26/h4-7,10,15H,2-3,8-9,11-13H2,1H3,(H3,27,28)(H,31,32)(H,33,34)/t15-/m0/s1 |
| InChIKey | ZASVQJYAFPWYQP-HNNXBMFYSA-N |
| XLogP | 3.27 |
| TPSA | 171.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.58 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|