C20H20FN3O8 — CID 53242075
(2R)-2-[[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylfuran-2-yl]-2-methylpropanoyl]amino]butanedioic acid (PubChem CID 53242075) has the molecular formula C20H20FN3O8 and a molecular weight of 449.39 g/mol. Its IUPAC name is (2R)-2-[[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylfuran-2-yl]-2-methylpropanoyl]amino]butanedioic acid.
| Compound Name | (2R)-2-[[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylfuran-2-yl]-2-methylpropanoyl]amino]butanedioic acid |
|---|---|
| PubChem CID | 53242075 |
| Molecular Formula | C20H20FN3O8 |
| Molecular Weight | 449.39 g/mol |
| Exact Mass | 449.12 |
| IUPAC Name | (2R)-2-[[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylfuran-2-yl]-2-methylpropanoyl]amino]butanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(CC(C)C(=O)N[C@H](CC(=O)O)C(=O)O)o2)c(F)c1 |
| InChI | InChI=1S/C20H20FN3O8/c1-9(18(27)24-13(19(28)29)8-16(25)26)6-11-3-5-15(31-11)20(30)32-14-4-2-10(17(22)23)7-12(14)21/h2-5,7,9,13H,6,8H2,1H3,(H3,22,23)(H,24,27)(H,25,26)(H,28,29)/t9?,13-/m1/s1 |
| InChIKey | DNYIAXWWSUGOGI-WCRCJTMVSA-N |
| XLogP | 1.14 |
| TPSA | 193.01 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.39 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|