C19H18FN3O7S — CID 53242119
(2R)-2-[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]propanoylamino]butanedioic acid (PubChem CID 53242119) has the molecular formula C19H18FN3O7S and a molecular weight of 451.43 g/mol. Its IUPAC name is (2R)-2-[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]propanoylamino]butanedioic acid.
| Compound Name | (2R)-2-[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]propanoylamino]butanedioic acid |
|---|---|
| PubChem CID | 53242119 |
| Molecular Formula | C19H18FN3O7S |
| Molecular Weight | 451.43 g/mol |
| Exact Mass | 451.08 |
| IUPAC Name | (2R)-2-[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]propanoylamino]butanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(CCC(=O)N[C@H](CC(=O)O)C(=O)O)s2)c(F)c1 |
| InChI | InChI=1S/C19H18FN3O7S/c20-11-7-9(17(21)22)1-4-13(11)30-19(29)14-5-2-10(31-14)3-6-15(24)23-12(18(27)28)8-16(25)26/h1-2,4-5,7,12H,3,6,8H2,(H3,21,22)(H,23,24)(H,25,26)(H,27,28)/t12-/m1/s1 |
| InChIKey | HCTJKQXXQCXJBI-GFCCVEGCSA-N |
| XLogP | 1.37 |
| TPSA | 179.87 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.43 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|