C21H21F4N3O8S — CID 74983039
(2S)-2-[[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2-methylpropanoyl]amino]-3-hydroxypropanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 74983039) has the molecular formula C21H21F4N3O8S and a molecular weight of 551.47 g/mol. Its IUPAC name is (2S)-2-[[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2-methylpropanoyl]amino]-3-hydroxypropanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2S)-2-[[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2-methylpropanoyl]amino]-3-hydroxypropanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 74983039 |
| Molecular Formula | C21H21F4N3O8S |
| Molecular Weight | 551.47 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | (2S)-2-[[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2-methylpropanoyl]amino]-3-hydroxypropanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(OC(=O)c2ccc(CC(C)C(=O)N[C@@H](CO)C(=O)O)s2)c(F)c1 |
| InChI | InChI=1S/C19H20FN3O6S.C2HF3O2/c1-9(17(25)23-13(8-24)18(26)27)6-11-3-5-15(30-11)19(28)29-14-4-2-10(16(21)22)7-12(14)20;3-2(4,5)1(6)7/h2-5,7,9,13,24H,6,8H2,1H3,(H3,21,22)(H,23,25)(H,26,27);(H,6,7)/t9?,13-;/m0./s1 |
| InChIKey | KKXDNWGYKKNLEZ-LGYSWELRSA-N |
| XLogP | 1.76 |
| TPSA | 200.10 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.47 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|