C30H29F4N3O9S — CID 169428279
3-[[2-[[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]methyl]-2-ethylbutanoyl]amino]-5-methoxycarbonylbenzoic acid;2,2,2-trifluoroacetic acid (PubChem CID 169428279) has the molecular formula C30H29F4N3O9S and a molecular weight of 683.63 g/mol. Its IUPAC name is 3-[[2-[[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]methyl]-2-ethylbutanoyl]amino]-5-methoxycarbonylbenzoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 3-[[2-[[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]methyl]-2-ethylbutanoyl]amino]-5-methoxycarbonylbenzoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 169428279 |
| Molecular Formula | C30H29F4N3O9S |
| Molecular Weight | 683.63 g/mol |
| Exact Mass | 683.16 |
| IUPAC Name | 3-[[2-[[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]methyl]-2-ethylbutanoyl]amino]-5-methoxycarbonylbenzoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(OC(=O)c2ccc(CC(CC)(CC)C(=O)Nc3cc(C(=O)O)cc(C(=O)OC)c3)s2)c(F)c1 |
| InChI | InChI=1S/C28H28FN3O7S.C2HF3O2/c1-4-28(5-2,27(37)32-18-11-16(24(33)34)10-17(12-18)25(35)38-3)14-19-7-9-22(40-19)26(36)39-21-8-6-15(23(30)31)13-20(21)29;3-2(4,5)1(6)7/h6-13H,4-5,14H2,1-3H3,(H3,30,31)(H,32,37)(H,33,34);(H,6,7) |
| InChIKey | USEBAVIHXZWCLP-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 206.17 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.63 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|