C21H21F4N3O10S2 — CID 74983048
(2R)-2-[[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2-methylpropanoyl]amino]-3-sulfopropanoic acid;2,2,2-trifluoroacetic acid (PubChem CID 74983048) has the molecular formula C21H21F4N3O10S2 and a molecular weight of 615.54 g/mol. Its IUPAC name is (2R)-2-[[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2-methylpropanoyl]amino]-3-sulfopropanoic acid;2,2,2-trifluoroacetic acid.
| Compound Name | (2R)-2-[[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2-methylpropanoyl]amino]-3-sulfopropanoic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 74983048 |
| Molecular Formula | C21H21F4N3O10S2 |
| Molecular Weight | 615.54 g/mol |
| Exact Mass | 615.06 |
| IUPAC Name | (2R)-2-[[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2-methylpropanoyl]amino]-3-sulfopropanoic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(OC(=O)c2ccc(CC(C)C(=O)N[C@@H](CS(=O)(=O)O)C(=O)O)s2)c(F)c1 |
| InChI | InChI=1S/C19H20FN3O8S2.C2HF3O2/c1-9(17(24)23-13(18(25)26)8-33(28,29)30)6-11-3-5-15(32-11)19(27)31-14-4-2-10(16(21)22)7-12(14)20;3-2(4,5)1(6)7/h2-5,7,9,13H,6,8H2,1H3,(H3,21,22)(H,23,24)(H,25,26)(H,28,29,30);(H,6,7)/t9?,13-;/m0./s1 |
| InChIKey | ZUKFMCAUURVLNV-LGYSWELRSA-N |
| XLogP | 1.66 |
| TPSA | 234.24 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.54 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|