C20H15F4N3O6S — CID 90106657
1-[[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]methyl]pyrrole-2-carboxylic acid;2,2,2-trifluoroacetic acid (PubChem CID 90106657) has the molecular formula C20H15F4N3O6S and a molecular weight of 501.41 g/mol. Its IUPAC name is 1-[[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]methyl]pyrrole-2-carboxylic acid;2,2,2-trifluoroacetic acid.
| Compound Name | 1-[[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]methyl]pyrrole-2-carboxylic acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 90106657 |
| Molecular Formula | C20H15F4N3O6S |
| Molecular Weight | 501.41 g/mol |
| Exact Mass | 501.06 |
| IUPAC Name | 1-[[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]methyl]pyrrole-2-carboxylic acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(OC(=O)c2ccc(Cn3cccc3C(=O)O)s2)c(F)c1 |
| InChI | InChI=1S/C18H14FN3O4S.C2HF3O2/c19-12-8-10(16(20)21)3-5-14(12)26-18(25)15-6-4-11(27-15)9-22-7-1-2-13(22)17(23)24;3-2(4,5)1(6)7/h1-8H,9H2,(H3,20,21)(H,23,24);(H,6,7) |
| InChIKey | GCFIXQWWCLKDJE-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 155.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.41 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|