C21H20F4N2O5S — CID 90018606
(4-carbamimidoyl-2-fluorophenyl) 5-[2-ethyl-2-(2,2,2-trifluoroacetyl)oxycarbonylbutyl]thiophene-2-carboxylate (PubChem CID 90018606) has the molecular formula C21H20F4N2O5S and a molecular weight of 488.46 g/mol. Its IUPAC name is (4-carbamimidoyl-2-fluorophenyl) 5-[2-ethyl-2-(2,2,2-trifluoroacetyl)oxycarbonylbutyl]thiophene-2-carboxylate.
| Compound Name | (4-carbamimidoyl-2-fluorophenyl) 5-[2-ethyl-2-(2,2,2-trifluoroacetyl)oxycarbonylbutyl]thiophene-2-carboxylate |
|---|---|
| PubChem CID | 90018606 |
| Molecular Formula | C21H20F4N2O5S |
| Molecular Weight | 488.46 g/mol |
| Exact Mass | 488.10 |
| IUPAC Name | (4-carbamimidoyl-2-fluorophenyl) 5-[2-ethyl-2-(2,2,2-trifluoroacetyl)oxycarbonylbutyl]thiophene-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(CC(CC)(CC)C(=O)OC(=O)C(F)(F)F)s2)c(F)c1 |
| InChI | InChI=1S/C21H20F4N2O5S/c1-3-20(4-2,18(29)32-19(30)21(23,24)25)10-12-6-8-15(33-12)17(28)31-14-7-5-11(16(26)27)9-13(14)22/h5-9H,3-4,10H2,1-2H3,(H3,26,27) |
| InChIKey | DQHCKNIOTJKYSQ-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 119.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.46 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|