C17H16FN3O2S — CID 175800953
(4-carbamimidoyl-2-fluorophenyl) 3-ethyl-2H-1,3-benzothiazole-6-carboxylate (PubChem CID 175800953) has the molecular formula C17H16FN3O2S and a molecular weight of 345.40 g/mol. Its IUPAC name is (4-carbamimidoyl-2-fluorophenyl) 3-ethyl-2H-1,3-benzothiazole-6-carboxylate.
| Compound Name | (4-carbamimidoyl-2-fluorophenyl) 3-ethyl-2H-1,3-benzothiazole-6-carboxylate |
|---|---|
| PubChem CID | 175800953 |
| Molecular Formula | C17H16FN3O2S |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.09 |
| IUPAC Name | (4-carbamimidoyl-2-fluorophenyl) 3-ethyl-2H-1,3-benzothiazole-6-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc3c(c2)SCN3CC)c(F)c1 |
| InChI | InChI=1S/C17H16FN3O2S/c1-2-21-9-24-15-8-11(3-5-13(15)21)17(22)23-14-6-4-10(16(19)20)7-12(14)18/h3-8H,2,9H2,1H3,(H3,19,20) |
| InChIKey | LFYVGZHKHPLMEV-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 79.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|