C16H15FN2OS — CID 107666639
4-(2,3-dihydro-1-benzothiophen-2-ylmethoxy)-3-fluorobenzenecarboximidamide (PubChem CID 107666639) has the molecular formula C16H15FN2OS and a molecular weight of 302.37 g/mol. Its IUPAC name is 4-(2,3-dihydro-1-benzothiophen-2-ylmethoxy)-3-fluorobenzenecarboximidamide.
| Compound Name | 4-(2,3-dihydro-1-benzothiophen-2-ylmethoxy)-3-fluorobenzenecarboximidamide |
|---|---|
| PubChem CID | 107666639 |
| Molecular Formula | C16H15FN2OS |
| Molecular Weight | 302.37 g/mol |
| Exact Mass | 302.09 |
| IUPAC Name | 4-(2,3-dihydro-1-benzothiophen-2-ylmethoxy)-3-fluorobenzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(OCC2Cc3ccccc3S2)c(F)c1 |
| InChI | InChI=1S/C16H15FN2OS/c17-13-8-11(16(18)19)5-6-14(13)20-9-12-7-10-3-1-2-4-15(10)21-12/h1-6,8,12H,7,9H2,(H3,18,19) |
| InChIKey | KUMZLDVVHHBNGU-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 59.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.37 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|