C22H23FN4O7S — CID 90105510
(2S)-2-[[2-[2-(4-carbamimidoyl-2-fluorophenoxy)carbonyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]acetyl]amino]pentanedioic acid (PubChem CID 90105510) has the molecular formula C22H23FN4O7S and a molecular weight of 506.51 g/mol. Its IUPAC name is (2S)-2-[[2-[2-(4-carbamimidoyl-2-fluorophenoxy)carbonyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]acetyl]amino]pentanedioic acid.
| Compound Name | (2S)-2-[[2-[2-(4-carbamimidoyl-2-fluorophenoxy)carbonyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]acetyl]amino]pentanedioic acid |
|---|---|
| PubChem CID | 90105510 |
| Molecular Formula | C22H23FN4O7S |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.13 |
| IUPAC Name | (2S)-2-[[2-[2-(4-carbamimidoyl-2-fluorophenoxy)carbonyl-5,7-dihydro-4H-thieno[2,3-c]pyridin-6-yl]acetyl]amino]pentanedioic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2cc3c(s2)CN(CC(=O)N[C@@H](CCC(=O)O)C(=O)O)CC3)c(F)c1 |
| InChI | InChI=1S/C22H23FN4O7S/c23-13-7-12(20(24)25)1-3-15(13)34-22(33)16-8-11-5-6-27(9-17(11)35-16)10-18(28)26-14(21(31)32)2-4-19(29)30/h1,3,7-8,14H,2,4-6,9-10H2,(H3,24,25)(H,26,28)(H,29,30)(H,31,32)/t14-/m0/s1 |
| InChIKey | KPYBHHWXHUIEKU-AWEZNQCLSA-N |
| XLogP | 1.18 |
| TPSA | 183.11 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|