C23H25FN4O7S — CID 159765996
3-[[(2R)-1-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2-methylpyrrolidine-2-carbonyl]-(carboxymethyl)amino]propanoic acid (PubChem CID 159765996) has the molecular formula C23H25FN4O7S and a molecular weight of 520.54 g/mol. Its IUPAC name is 3-[[(2R)-1-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2-methylpyrrolidine-2-carbonyl]-(carboxymethyl)amino]propanoic acid.
| Compound Name | 3-[[(2R)-1-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2-methylpyrrolidine-2-carbonyl]-(carboxymethyl)amino]propanoic acid |
|---|---|
| PubChem CID | 159765996 |
| Molecular Formula | C23H25FN4O7S |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.14 |
| IUPAC Name | 3-[[(2R)-1-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2-methylpyrrolidine-2-carbonyl]-(carboxymethyl)amino]propanoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(N3CCC[C@]3(C)C(=O)N(CCC(=O)O)CC(=O)O)s2)c(F)c1 |
| InChI | InChI=1S/C23H25FN4O7S/c1-23(22(34)27(12-19(31)32)10-7-18(29)30)8-2-9-28(23)17-6-5-16(36-17)21(33)35-15-4-3-13(20(25)26)11-14(15)24/h3-6,11H,2,7-10,12H2,1H3,(H3,25,26)(H,29,30)(H,31,32)/t23-/m1/s1 |
| InChIKey | NFMUYWPMHPMMED-HSZRJFAPSA-N |
| XLogP | 2.14 |
| TPSA | 174.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|