C24H22FN3O7S — CID 118909045
5-[[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2,2-dimethylpropanoyl]amino]-2-hydroxybenzenecarboperoxoic acid (PubChem CID 118909045) has the molecular formula C24H22FN3O7S and a molecular weight of 515.52 g/mol. Its IUPAC name is 5-[[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2,2-dimethylpropanoyl]amino]-2-hydroxybenzenecarboperoxoic acid.
| Compound Name | 5-[[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2,2-dimethylpropanoyl]amino]-2-hydroxybenzenecarboperoxoic acid |
|---|---|
| PubChem CID | 118909045 |
| Molecular Formula | C24H22FN3O7S |
| Molecular Weight | 515.52 g/mol |
| Exact Mass | 515.12 |
| IUPAC Name | 5-[[3-[5-(4-carbamimidoyl-2-fluorophenoxy)carbonylthiophen-2-yl]-2,2-dimethylpropanoyl]amino]-2-hydroxybenzenecarboperoxoic acid |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(CC(C)(C)C(=O)Nc3ccc(O)c(C(=O)OO)c3)s2)c(F)c1 |
| InChI | InChI=1S/C24H22FN3O7S/c1-24(2,23(32)28-13-4-6-17(29)15(10-13)21(30)35-33)11-14-5-8-19(36-14)22(31)34-18-7-3-12(20(26)27)9-16(18)25/h3-10,29,33H,11H2,1-2H3,(H3,26,27)(H,28,32) |
| InChIKey | QXXZEAIGHZYLOW-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 172.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.52 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|