C22H21F3N2O9S2 — CID 89048839
4-[3-[5-(4-carbamimidoylphenoxy)carbonylfuran-2-yl]-2-methylpropanoyl]sulfanyl-2-hydroxy-4-oxobutanethioic S-acid;2,2,2-trifluoroacetic acid (PubChem CID 89048839) has the molecular formula C22H21F3N2O9S2 and a molecular weight of 578.54 g/mol. Its IUPAC name is 4-[3-[5-(4-carbamimidoylphenoxy)carbonylfuran-2-yl]-2-methylpropanoyl]sulfanyl-2-hydroxy-4-oxobutanethioic S-acid;2,2,2-trifluoroacetic acid.
| Compound Name | 4-[3-[5-(4-carbamimidoylphenoxy)carbonylfuran-2-yl]-2-methylpropanoyl]sulfanyl-2-hydroxy-4-oxobutanethioic S-acid;2,2,2-trifluoroacetic acid |
|---|---|
| PubChem CID | 89048839 |
| Molecular Formula | C22H21F3N2O9S2 |
| Molecular Weight | 578.54 g/mol |
| Exact Mass | 578.06 |
| IUPAC Name | 4-[3-[5-(4-carbamimidoylphenoxy)carbonylfuran-2-yl]-2-methylpropanoyl]sulfanyl-2-hydroxy-4-oxobutanethioic S-acid;2,2,2-trifluoroacetic acid |
| SMILES | O=C(O)C(F)(F)F.[H]/N=C(\N)c1ccc(OC(=O)c2ccc(CC(C)C(=O)SC(=O)CC(O)C(=O)S)o2)cc1 |
| InChI | InChI=1S/C20H20N2O7S2.C2HF3O2/c1-10(20(27)31-16(24)9-14(23)19(26)30)8-13-6-7-15(28-13)18(25)29-12-4-2-11(3-5-12)17(21)22;3-2(4,5)1(6)7/h2-7,10,14,23H,8-9H2,1H3,(H3,21,22)(H,26,30);(H,6,7) |
| InChIKey | ZSSVOPCKIOZVTH-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 198.05 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.54 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|