C24H28N2O8S — CID 89048877
(4-carbamimidoylphenyl) 5-[(4S)-4-ethoxycarbonyl-6-ethylsulfanyl-4-hydroxy-2-methyl-3,6-dioxohexyl]furan-2-carboxylate (PubChem CID 89048877) has the molecular formula C24H28N2O8S and a molecular weight of 504.56 g/mol. Its IUPAC name is (4-carbamimidoylphenyl) 5-[(4S)-4-ethoxycarbonyl-6-ethylsulfanyl-4-hydroxy-2-methyl-3,6-dioxohexyl]furan-2-carboxylate.
| Compound Name | (4-carbamimidoylphenyl) 5-[(4S)-4-ethoxycarbonyl-6-ethylsulfanyl-4-hydroxy-2-methyl-3,6-dioxohexyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 89048877 |
| Molecular Formula | C24H28N2O8S |
| Molecular Weight | 504.56 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | (4-carbamimidoylphenyl) 5-[(4S)-4-ethoxycarbonyl-6-ethylsulfanyl-4-hydroxy-2-methyl-3,6-dioxohexyl]furan-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(CC(C)C(=O)[C@@](O)(CC(=O)SCC)C(=O)OCC)o2)cc1 |
| InChI | InChI=1S/C24H28N2O8S/c1-4-32-23(30)24(31,13-19(27)35-5-2)20(28)14(3)12-17-10-11-18(33-17)22(29)34-16-8-6-15(7-9-16)21(25)26/h6-11,14,31H,4-5,12-13H2,1-3H3,(H3,25,26)/t14?,24-/m0/s1 |
| InChIKey | FLVXASKHMGJPPY-UUTCKOJZSA-N |
| XLogP | 2.49 |
| TPSA | 169.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.56 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|