C20H19F3N2O6 — CID 89048960
(4-carbamimidoylphenyl) 5-[2-methyl-5-oxo-5-(2,2,2-trifluoroacetyl)oxypentyl]furan-2-carboxylate (PubChem CID 89048960) has the molecular formula C20H19F3N2O6 and a molecular weight of 440.37 g/mol. Its IUPAC name is (4-carbamimidoylphenyl) 5-[2-methyl-5-oxo-5-(2,2,2-trifluoroacetyl)oxypentyl]furan-2-carboxylate.
| Compound Name | (4-carbamimidoylphenyl) 5-[2-methyl-5-oxo-5-(2,2,2-trifluoroacetyl)oxypentyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 89048960 |
| Molecular Formula | C20H19F3N2O6 |
| Molecular Weight | 440.37 g/mol |
| Exact Mass | 440.12 |
| IUPAC Name | (4-carbamimidoylphenyl) 5-[2-methyl-5-oxo-5-(2,2,2-trifluoroacetyl)oxypentyl]furan-2-carboxylate |
| SMILES | [H]/N=C(\N)c1ccc(OC(=O)c2ccc(CC(C)CCC(=O)OC(=O)C(F)(F)F)o2)cc1 |
| InChI | InChI=1S/C20H19F3N2O6/c1-11(2-9-16(26)31-19(28)20(21,22)23)10-14-7-8-15(29-14)18(27)30-13-5-3-12(4-6-13)17(24)25/h3-8,11H,2,9-10H2,1H3,(H3,24,25) |
| InChIKey | AUZOFKFFOUYVJE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 132.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.37 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|