C16H17N5 — CID 90124150
2-(4-carbamimidoylphenyl)-2,3-dihydro-1H-indole-6-carboximidamide (PubChem CID 90124150) has the molecular formula C16H17N5 and a molecular weight of 279.35 g/mol. Its IUPAC name is 2-(4-carbamimidoylphenyl)-2,3-dihydro-1H-indole-6-carboximidamide.
| Compound Name | 2-(4-carbamimidoylphenyl)-2,3-dihydro-1H-indole-6-carboximidamide |
|---|---|
| PubChem CID | 90124150 |
| Molecular Formula | C16H17N5 |
| Molecular Weight | 279.35 g/mol |
| Exact Mass | 279.15 |
| IUPAC Name | 2-(4-carbamimidoylphenyl)-2,3-dihydro-1H-indole-6-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C2Cc3ccc(/C(N)=N/[H])cc3N2)cc1 |
| InChI | InChI=1S/C16H17N5/c17-15(18)10-3-1-9(2-4-10)13-7-11-5-6-12(16(19)20)8-14(11)21-13/h1-6,8,13,21H,7H2,(H3,17,18)(H3,19,20) |
| InChIKey | WHTYTNXXOGWAOB-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.35 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|