C18H21N5 — CID 59617177
4-[5-(4-carbamimidoylphenyl)-1-deuteriopyrrolidin-2-yl]benzenecarboximidamide (PubChem CID 59617177) has the molecular formula C18H21N5 and a molecular weight of 308.41 g/mol. Its IUPAC name is 4-[5-(4-carbamimidoylphenyl)-1-deuteriopyrrolidin-2-yl]benzenecarboximidamide.
| Compound Name | 4-[5-(4-carbamimidoylphenyl)-1-deuteriopyrrolidin-2-yl]benzenecarboximidamide |
|---|---|
| PubChem CID | 59617177 |
| Molecular Formula | C18H21N5 |
| Molecular Weight | 308.41 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 4-[5-(4-carbamimidoylphenyl)-1-deuteriopyrrolidin-2-yl]benzenecarboximidamide |
| SMILES | [H]/N=C(\N)c1ccc(C2CCC(c3ccc(/C(N)=N/[H])cc3)N2[2H])cc1 |
| InChI | InChI=1S/C18H21N5/c19-17(20)13-5-1-11(2-6-13)15-9-10-16(23-15)12-3-7-14(8-4-12)18(21)22/h1-8,15-16,23H,9-10H2,(H3,19,20)(H3,21,22)/i/hD |
| InChIKey | TVJCMDXHZFYKDO-DYCDLGHISA-N |
| XLogP | 2.42 |
| TPSA | 111.77 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.41 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|