C17H17N3 — CID 67561140
(6aR)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboximidamide (PubChem CID 67561140) has the molecular formula C17H17N3 and a molecular weight of 263.34 g/mol. Its IUPAC name is (6aR)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboximidamide.
| Compound Name | (6aR)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboximidamide |
|---|---|
| PubChem CID | 67561140 |
| Molecular Formula | C17H17N3 |
| Molecular Weight | 263.34 g/mol |
| Exact Mass | 263.14 |
| IUPAC Name | (6aR)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)C1c3ccccc3C[C@H]1CN2 |
| InChI | InChI=1S/C17H17N3/c18-17(19)11-5-6-15-14(8-11)16-12(9-20-15)7-10-3-1-2-4-13(10)16/h1-6,8,12,16,20H,7,9H2,(H3,18,19)/t12-,16?/m0/s1 |
| InChIKey | JCVQRUPIKRCJNO-HKALDPMFSA-N |
| XLogP | 2.70 |
| TPSA | 61.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.34 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|