C21H21N5 — CID 22633252
6-(5-methyl-1H-pyrazol-4-yl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboximidamide (PubChem CID 22633252) has the molecular formula C21H21N5 and a molecular weight of 343.43 g/mol. Its IUPAC name is 6-(5-methyl-1H-pyrazol-4-yl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboximidamide.
| Compound Name | 6-(5-methyl-1H-pyrazol-4-yl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboximidamide |
|---|---|
| PubChem CID | 22633252 |
| Molecular Formula | C21H21N5 |
| Molecular Weight | 343.43 g/mol |
| Exact Mass | 343.18 |
| IUPAC Name | 6-(5-methyl-1H-pyrazol-4-yl)-6,6a,7,11b-tetrahydro-5H-indeno[2,1-c]quinoline-2-carboximidamide |
| SMILES | [H]/N=C(\N)c1ccc2c(c1)C1c3ccccc3CC1C(c1cn[nH]c1C)N2 |
| InChI | InChI=1S/C21H21N5/c1-11-17(10-24-26-11)20-16-8-12-4-2-3-5-14(12)19(16)15-9-13(21(22)23)6-7-18(15)25-20/h2-7,9-10,16,19-20,25H,8H2,1H3,(H3,22,23)(H,24,26) |
| InChIKey | HLCGIFQEFLAFMR-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 90.58 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.43 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|