C11H13NO — CID 130684049
[(2R)-6-ethenyl-2,3-dihydro-1H-indol-2-yl]methanol (PubChem CID 130684049) has the molecular formula C11H13NO and a molecular weight of 175.23 g/mol. Its IUPAC name is [(2R)-6-ethenyl-2,3-dihydro-1H-indol-2-yl]methanol.
| Compound Name | [(2R)-6-ethenyl-2,3-dihydro-1H-indol-2-yl]methanol |
|---|---|
| PubChem CID | 130684049 |
| Molecular Formula | C11H13NO |
| Molecular Weight | 175.23 g/mol |
| Exact Mass | 175.10 |
| IUPAC Name | [(2R)-6-ethenyl-2,3-dihydro-1H-indol-2-yl]methanol |
| SMILES | C=Cc1ccc2c(c1)N[C@@H](CO)C2 |
| InChI | InChI=1S/C11H13NO/c1-2-8-3-4-9-6-10(7-13)12-11(9)5-8/h2-5,10,12-13H,1,6-7H2/t10-/m1/s1 |
| InChIKey | TWPMLROYOMLIHJ-SNVBAGLBSA-N |
| XLogP | 1.66 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.23 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |