C9H10INO — CID 130708719
[(2R)-6-iodo-2,3-dihydro-1H-indol-2-yl]methanol (PubChem CID 130708719) has the molecular formula C9H10INO and a molecular weight of 275.09 g/mol. Its IUPAC name is [(2R)-6-iodo-2,3-dihydro-1H-indol-2-yl]methanol.
| Compound Name | [(2R)-6-iodo-2,3-dihydro-1H-indol-2-yl]methanol |
|---|---|
| PubChem CID | 130708719 |
| Molecular Formula | C9H10INO |
| Molecular Weight | 275.09 g/mol |
| Exact Mass | 274.98 |
| IUPAC Name | [(2R)-6-iodo-2,3-dihydro-1H-indol-2-yl]methanol |
| SMILES | OC[C@H]1Cc2ccc(I)cc2N1 |
| InChI | InChI=1S/C9H10INO/c10-7-2-1-6-3-8(5-12)11-9(6)4-7/h1-2,4,8,11-12H,3,5H2/t8-/m1/s1 |
| InChIKey | FDRXMVQRVSZTRT-MRVPVSSYSA-N |
| XLogP | 1.62 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.09 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|