C11H12 — CID 59801498
5-ethenyl-2,3-dihydro-1H-indene (PubChem CID 59801498) has the molecular formula C11H12 and a molecular weight of 144.22 g/mol. Its IUPAC name is 5-ethenyl-2,3-dihydro-1H-indene.
| Compound Name | 5-ethenyl-2,3-dihydro-1H-indene |
|---|---|
| PubChem CID | 59801498 |
| Molecular Formula | C11H12 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 5-ethenyl-2,3-dihydro-1H-indene |
| SMILES | C=Cc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C11H12/c1-2-9-6-7-10-4-3-5-11(10)8-9/h2,6-8H,1,3-5H2 |
| InChIKey | GEAOIOKEVBQCPX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |