C12H15N — CID 134268692
N-(2,3-dihydro-1H-inden-5-ylmethyl)ethenamine (PubChem CID 134268692) has the molecular formula C12H15N and a molecular weight of 173.26 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-ylmethyl)ethenamine.
| Compound Name | N-(2,3-dihydro-1H-inden-5-ylmethyl)ethenamine |
|---|---|
| PubChem CID | 134268692 |
| Molecular Formula | C12H15N |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.12 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-ylmethyl)ethenamine |
| SMILES | C=CNCc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C12H15N/c1-2-13-9-10-6-7-11-4-3-5-12(11)8-10/h2,6-8,13H,1,3-5,9H2 |
| InChIKey | YAGJZVUXNMHHDL-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |