C15H21N — CID 115660114
(E)-N-(2,3-dihydro-1H-inden-5-ylmethyl)pent-3-en-1-amine (PubChem CID 115660114) has the molecular formula C15H21N and a molecular weight of 215.34 g/mol. Its IUPAC name is (E)-N-(2,3-dihydro-1H-inden-5-ylmethyl)pent-3-en-1-amine.
| Compound Name | (E)-N-(2,3-dihydro-1H-inden-5-ylmethyl)pent-3-en-1-amine |
|---|---|
| PubChem CID | 115660114 |
| Molecular Formula | C15H21N |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.17 |
| IUPAC Name | (E)-N-(2,3-dihydro-1H-inden-5-ylmethyl)pent-3-en-1-amine |
| SMILES | C/C=C/CCNCc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H21N/c1-2-3-4-10-16-12-13-8-9-14-6-5-7-15(14)11-13/h2-3,8-9,11,16H,4-7,10,12H2,1H3/b3-2+ |
| InChIKey | OZMYGBZTUUDGGH-NSCUHMNNSA-N |
| XLogP | 3.23 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|