C14H20BrN — CID 106844899
4-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)butan-1-amine (PubChem CID 106844899) has the molecular formula C14H20BrN and a molecular weight of 282.23 g/mol. Its IUPAC name is 4-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)butan-1-amine.
| Compound Name | 4-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)butan-1-amine |
|---|---|
| PubChem CID | 106844899 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.23 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 4-bromo-N-(2,3-dihydro-1H-inden-5-ylmethyl)butan-1-amine |
| SMILES | BrCCCCNCc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C14H20BrN/c15-8-1-2-9-16-11-12-6-7-13-4-3-5-14(13)10-12/h6-7,10,16H,1-5,8-9,11H2 |
| InChIKey | LFNATBNZVOEEGP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|