C16H22N2O — CID 115629535
N-[2-(2,3-dihydro-1H-inden-5-ylmethylamino)ethyl]cyclopropanecarboxamide (PubChem CID 115629535) has the molecular formula C16H22N2O and a molecular weight of 258.36 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-inden-5-ylmethylamino)ethyl]cyclopropanecarboxamide.
| Compound Name | N-[2-(2,3-dihydro-1H-inden-5-ylmethylamino)ethyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 115629535 |
| Molecular Formula | C16H22N2O |
| Molecular Weight | 258.36 g/mol |
| Exact Mass | 258.17 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-inden-5-ylmethylamino)ethyl]cyclopropanecarboxamide |
| SMILES | O=C(NCCNCc1ccc2c(c1)CCC2)C1CC1 |
| InChI | InChI=1S/C16H22N2O/c19-16(14-6-7-14)18-9-8-17-11-12-4-5-13-2-1-3-15(13)10-12/h4-5,10,14,17H,1-3,6-9,11H2,(H,18,19) |
| InChIKey | UEGMXYAQDOKRAH-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|