C16H21NO — CID 110787783
N-[2-(2,3-dihydro-1H-inden-5-yl)ethyl]cyclobutanecarboxamide (PubChem CID 110787783) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is N-[2-(2,3-dihydro-1H-inden-5-yl)ethyl]cyclobutanecarboxamide.
| Compound Name | N-[2-(2,3-dihydro-1H-inden-5-yl)ethyl]cyclobutanecarboxamide |
|---|---|
| PubChem CID | 110787783 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | N-[2-(2,3-dihydro-1H-inden-5-yl)ethyl]cyclobutanecarboxamide |
| SMILES | O=C(NCCc1ccc2c(c1)CCC2)C1CCC1 |
| InChI | InChI=1S/C16H21NO/c18-16(14-4-2-5-14)17-10-9-12-7-8-13-3-1-6-15(13)11-12/h7-8,11,14H,1-6,9-10H2,(H,17,18) |
| InChIKey | QBRIEKGBUVYYII-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |