C14H16N2O2 — CID 89385442
N-[(2-formyl-1,3-dihydroisoindol-5-yl)methyl]cyclopropanecarboxamide (PubChem CID 89385442) has the molecular formula C14H16N2O2 and a molecular weight of 244.29 g/mol. Its IUPAC name is N-[(2-formyl-1,3-dihydroisoindol-5-yl)methyl]cyclopropanecarboxamide.
| Compound Name | N-[(2-formyl-1,3-dihydroisoindol-5-yl)methyl]cyclopropanecarboxamide |
|---|---|
| PubChem CID | 89385442 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | N-[(2-formyl-1,3-dihydroisoindol-5-yl)methyl]cyclopropanecarboxamide |
| SMILES | O=CN1Cc2ccc(CNC(=O)C3CC3)cc2C1 |
| InChI | InChI=1S/C14H16N2O2/c17-9-16-7-12-2-1-10(5-13(12)8-16)6-15-14(18)11-3-4-11/h1-2,5,9,11H,3-4,6-8H2,(H,15,18) |
| InChIKey | GCYGOFLOCVDPGK-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|