C15H19NO2 — CID 110784247
N-(3,4-dihydro-2H-chromen-6-ylmethyl)cyclobutanecarboxamide (PubChem CID 110784247) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is N-(3,4-dihydro-2H-chromen-6-ylmethyl)cyclobutanecarboxamide.
| Compound Name | N-(3,4-dihydro-2H-chromen-6-ylmethyl)cyclobutanecarboxamide |
|---|---|
| PubChem CID | 110784247 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | N-(3,4-dihydro-2H-chromen-6-ylmethyl)cyclobutanecarboxamide |
| SMILES | O=C(NCc1ccc2c(c1)CCCO2)C1CCC1 |
| InChI | InChI=1S/C15H19NO2/c17-15(12-3-1-4-12)16-10-11-6-7-14-13(9-11)5-2-8-18-14/h6-7,9,12H,1-5,8,10H2,(H,16,17) |
| InChIKey | CRTMVTAMAOKBMO-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |