C15H18N2O2 — CID 125443999
(2S)-N-(3,4-dihydro-2H-chromen-6-ylmethyl)-2,5-dihydro-1H-pyrrole-2-carboxamide (PubChem CID 125443999) has the molecular formula C15H18N2O2 and a molecular weight of 258.32 g/mol. Its IUPAC name is (2S)-N-(3,4-dihydro-2H-chromen-6-ylmethyl)-2,5-dihydro-1H-pyrrole-2-carboxamide.
| Compound Name | (2S)-N-(3,4-dihydro-2H-chromen-6-ylmethyl)-2,5-dihydro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 125443999 |
| Molecular Formula | C15H18N2O2 |
| Molecular Weight | 258.32 g/mol |
| Exact Mass | 258.14 |
| IUPAC Name | (2S)-N-(3,4-dihydro-2H-chromen-6-ylmethyl)-2,5-dihydro-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCc1ccc2c(c1)CCCO2)[C@@H]1C=CCN1 |
| InChI | InChI=1S/C15H18N2O2/c18-15(13-4-1-7-16-13)17-10-11-5-6-14-12(9-11)3-2-8-19-14/h1,4-6,9,13,16H,2-3,7-8,10H2,(H,17,18)/t13-/m0/s1 |
| InChIKey | VESRVZWBZKEGKH-ZDUSSCGKSA-N |
| XLogP | 1.16 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.32 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|