C14H16N2O3 — CID 125439859
(2S)-N-[2-(1,3-benzodioxol-5-yl)ethyl]-2,5-dihydro-1H-pyrrole-2-carboxamide (PubChem CID 125439859) has the molecular formula C14H16N2O3 and a molecular weight of 260.29 g/mol. Its IUPAC name is (2S)-N-[2-(1,3-benzodioxol-5-yl)ethyl]-2,5-dihydro-1H-pyrrole-2-carboxamide.
| Compound Name | (2S)-N-[2-(1,3-benzodioxol-5-yl)ethyl]-2,5-dihydro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 125439859 |
| Molecular Formula | C14H16N2O3 |
| Molecular Weight | 260.29 g/mol |
| Exact Mass | 260.12 |
| IUPAC Name | (2S)-N-[2-(1,3-benzodioxol-5-yl)ethyl]-2,5-dihydro-1H-pyrrole-2-carboxamide |
| SMILES | O=C(NCCc1ccc2c(c1)OCO2)[C@@H]1C=CCN1 |
| InChI | InChI=1S/C14H16N2O3/c17-14(11-2-1-6-15-11)16-7-5-10-3-4-12-13(8-10)19-9-18-12/h1-4,8,11,15H,5-7,9H2,(H,16,17)/t11-/m0/s1 |
| InChIKey | UPSRRGBLOBTFSM-NSHDSACASA-N |
| XLogP | 0.60 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|