C13H13N3O — CID 21131950
N-[(4-cyanophenyl)methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide (PubChem CID 21131950) has the molecular formula C13H13N3O and a molecular weight of 227.27 g/mol. Its IUPAC name is N-[(4-cyanophenyl)methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide.
| Compound Name | N-[(4-cyanophenyl)methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 21131950 |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.27 g/mol |
| Exact Mass | 227.11 |
| IUPAC Name | N-[(4-cyanophenyl)methyl]-2,5-dihydro-1H-pyrrole-2-carboxamide |
| SMILES | N#Cc1ccc(CNC(=O)C2C=CCN2)cc1 |
| InChI | InChI=1S/C13H13N3O/c14-8-10-3-5-11(6-4-10)9-16-13(17)12-2-1-7-15-12/h1-6,12,15H,7,9H2,(H,16,17) |
| InChIKey | SLDQPZYEZRXFPO-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 64.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.27 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|