C15H22ClN — CID 107319955
5-chloro-N-(2,3-dihydro-1H-inden-5-ylmethyl)pentan-1-amine (PubChem CID 107319955) has the molecular formula C15H22ClN and a molecular weight of 251.80 g/mol. Its IUPAC name is 5-chloro-N-(2,3-dihydro-1H-inden-5-ylmethyl)pentan-1-amine.
| Compound Name | 5-chloro-N-(2,3-dihydro-1H-inden-5-ylmethyl)pentan-1-amine |
|---|---|
| PubChem CID | 107319955 |
| Molecular Formula | C15H22ClN |
| Molecular Weight | 251.80 g/mol |
| Exact Mass | 251.14 |
| IUPAC Name | 5-chloro-N-(2,3-dihydro-1H-inden-5-ylmethyl)pentan-1-amine |
| SMILES | ClCCCCCNCc1ccc2c(c1)CCC2 |
| InChI | InChI=1S/C15H22ClN/c16-9-2-1-3-10-17-12-13-7-8-14-5-4-6-15(14)11-13/h7-8,11,17H,1-6,9-10,12H2 |
| InChIKey | HILYTOALAAZRNG-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.80 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|