C14H22N2 — CID 115629178
N,N-dimethyl-4-[[[(E)-pent-3-enyl]amino]methyl]aniline (PubChem CID 115629178) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is N,N-dimethyl-4-[[[(E)-pent-3-enyl]amino]methyl]aniline.
| Compound Name | N,N-dimethyl-4-[[[(E)-pent-3-enyl]amino]methyl]aniline |
|---|---|
| PubChem CID | 115629178 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | N,N-dimethyl-4-[[[(E)-pent-3-enyl]amino]methyl]aniline |
| SMILES | C/C=C/CCNCc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C14H22N2/c1-4-5-6-11-15-12-13-7-9-14(10-8-13)16(2)3/h4-5,7-10,15H,6,11-12H2,1-3H3/b5-4+ |
| InChIKey | NXAQDOPXXJODNQ-SNAWJCMRSA-N |
| XLogP | 2.81 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|