C13H24Cl2N2O — CID 17207022
4-[(3-methoxypropylamino)methyl]-N,N-dimethylaniline;dihydrochloride (PubChem CID 17207022) has the molecular formula C13H24Cl2N2O and a molecular weight of 295.25 g/mol. Its IUPAC name is 4-[(3-methoxypropylamino)methyl]-N,N-dimethylaniline;dihydrochloride.
| Compound Name | 4-[(3-methoxypropylamino)methyl]-N,N-dimethylaniline;dihydrochloride |
|---|---|
| PubChem CID | 17207022 |
| Molecular Formula | C13H24Cl2N2O |
| Molecular Weight | 295.25 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 4-[(3-methoxypropylamino)methyl]-N,N-dimethylaniline;dihydrochloride |
| SMILES | COCCCNCc1ccc(N(C)C)cc1.Cl.Cl |
| InChI | InChI=1S/C13H22N2O.2ClH/c1-15(2)13-7-5-12(6-8-13)11-14-9-4-10-16-3;;/h5-8,14H,4,9-11H2,1-3H3;2*1H |
| InChIKey | SAQMECLRANOWTE-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.25 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|