C13H15NO — CID 174657798
N-[(6-ethenyl-1,2,3,4-tetrahydronaphthalen-1-yl)methylidene]hydroxylamine (PubChem CID 174657798) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is N-[(6-ethenyl-1,2,3,4-tetrahydronaphthalen-1-yl)methylidene]hydroxylamine.
| Compound Name | N-[(6-ethenyl-1,2,3,4-tetrahydronaphthalen-1-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 174657798 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | N-[(6-ethenyl-1,2,3,4-tetrahydronaphthalen-1-yl)methylidene]hydroxylamine |
| SMILES | C=Cc1ccc2c(c1)CCCC2C=NO |
| InChI | InChI=1S/C13H15NO/c1-2-10-6-7-13-11(8-10)4-3-5-12(13)9-14-15/h2,6-9,12,15H,1,3-5H2 |
| InChIKey | FFVDCKBQWWUUKK-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|