C14H16 — CID 145472095
7-ethenyl-4-methyl-3-methylidene-2,4-dihydro-1H-naphthalene (PubChem CID 145472095) has the molecular formula C14H16 and a molecular weight of 184.28 g/mol. Its IUPAC name is 7-ethenyl-4-methyl-3-methylidene-2,4-dihydro-1H-naphthalene.
| Compound Name | 7-ethenyl-4-methyl-3-methylidene-2,4-dihydro-1H-naphthalene |
|---|---|
| PubChem CID | 145472095 |
| Molecular Formula | C14H16 |
| Molecular Weight | 184.28 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | 7-ethenyl-4-methyl-3-methylidene-2,4-dihydro-1H-naphthalene |
| SMILES | C=Cc1ccc2c(c1)CCC(=C)C2C |
| InChI | InChI=1S/C14H16/c1-4-12-6-8-14-11(3)10(2)5-7-13(14)9-12/h4,6,8-9,11H,1-2,5,7H2,3H3 |
| InChIKey | GBDUGPOLLPQSQI-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.28 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|