C17H25N — CID 142380822
4,6-dimethyl-3-methylidene-2,4-dihydro-1H-naphthalene;pyrrolidine (PubChem CID 142380822) has the molecular formula C17H25N and a molecular weight of 243.39 g/mol. Its IUPAC name is 4,6-dimethyl-3-methylidene-2,4-dihydro-1H-naphthalene;pyrrolidine.
| Compound Name | 4,6-dimethyl-3-methylidene-2,4-dihydro-1H-naphthalene;pyrrolidine |
|---|---|
| PubChem CID | 142380822 |
| Molecular Formula | C17H25N |
| Molecular Weight | 243.39 g/mol |
| Exact Mass | 243.20 |
| IUPAC Name | 4,6-dimethyl-3-methylidene-2,4-dihydro-1H-naphthalene;pyrrolidine |
| SMILES | C1CCNC1.C=C1CCc2ccc(C)cc2C1C |
| InChI | InChI=1S/C13H16.C4H9N/c1-9-4-6-12-7-5-10(2)11(3)13(12)8-9;1-2-4-5-3-1/h4,6,8,11H,2,5,7H2,1,3H3;5H,1-4H2 |
| InChIKey | NFAUSSYUJQWJAW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.39 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|