About (7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methanol
(7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methanol (PubChem CID 589411) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is (7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methanol.
Analyze (7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methanol?
The IUPAC name of (7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methanol (CID 589411) is (7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methanol.
What is the SMILES notation for (7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methanol?
The canonical SMILES for (7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methanol is Cc1ccc2c(c1)C(CO)CCC2.
What is the InChIKey of (7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methanol?
The InChIKey is SRUCIINYFREGPB-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-9-5-6-10-3-2-4-11(8-13)12(10)7-9/h5-7,11,13H,2-4,8H2,1H3.
What are the key properties of (7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methanol?
(7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methanol has a molecular weight of 176.26 g/mol, XLogP of 2.41, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (7-methyl-1,2,3,4-tetrahydronaphthalen-1-yl)methanol is sourced from PubChem (CID 589411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).