C14H15F5 — CID 129248402
7-methyl-1-(2,2,3,3,3-pentafluoropropyl)-1,2,3,4-tetrahydronaphthalene (PubChem CID 129248402) has the molecular formula C14H15F5 and a molecular weight of 278.26 g/mol. Its IUPAC name is 7-methyl-1-(2,2,3,3,3-pentafluoropropyl)-1,2,3,4-tetrahydronaphthalene.
| Compound Name | 7-methyl-1-(2,2,3,3,3-pentafluoropropyl)-1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 129248402 |
| Molecular Formula | C14H15F5 |
| Molecular Weight | 278.26 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 7-methyl-1-(2,2,3,3,3-pentafluoropropyl)-1,2,3,4-tetrahydronaphthalene |
| SMILES | Cc1ccc2c(c1)C(CC(F)(F)C(F)(F)F)CCC2 |
| InChI | InChI=1S/C14H15F5/c1-9-5-6-10-3-2-4-11(12(10)7-9)8-13(15,16)14(17,18)19/h5-7,11H,2-4,8H2,1H3 |
| InChIKey | XGHDAFMTCCZYKI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.26 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|