C18H26N2O2 — CID 139585722
(2R)-2-(2-hydroxy-5,6-dimethylhept-5-en-2-yl)-2,3-dihydro-1H-indole-5-carboxamide (PubChem CID 139585722) has the molecular formula C18H26N2O2 and a molecular weight of 302.42 g/mol. Its IUPAC name is (2R)-2-(2-hydroxy-5,6-dimethylhept-5-en-2-yl)-2,3-dihydro-1H-indole-5-carboxamide.
| Compound Name | (2R)-2-(2-hydroxy-5,6-dimethylhept-5-en-2-yl)-2,3-dihydro-1H-indole-5-carboxamide |
|---|---|
| PubChem CID | 139585722 |
| Molecular Formula | C18H26N2O2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.20 |
| IUPAC Name | (2R)-2-(2-hydroxy-5,6-dimethylhept-5-en-2-yl)-2,3-dihydro-1H-indole-5-carboxamide |
| SMILES | CC(C)=C(C)CCC(C)(O)[C@H]1Cc2cc(C(N)=O)ccc2N1 |
| InChI | InChI=1S/C18H26N2O2/c1-11(2)12(3)7-8-18(4,22)16-10-14-9-13(17(19)21)5-6-15(14)20-16/h5-6,9,16,20,22H,7-8,10H2,1-4H3,(H2,19,21)/t16-,18?/m1/s1 |
| InChIKey | DNEIBKUDDSXUHC-PYUWXLGESA-N |
| XLogP | 3.01 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|